About 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one
6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 15586443) has the molecular formula C22H24N4OS
and a molecular weight of 392.53 g/mol. Its IUPAC name is 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 15586443 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1nc2sccn2c(=O)c1CCN1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C22H24N4OS/c1-15-17(21(27)26-12-13-28-22(26)24-15)8-11-25-9-6-16(7-10-25)19-14-23-20-5-3-2-4-18(19)20/h2-5,12-14,16,23H,6-11H2,1H3 |
| InChIKey | HEGHIGMRJKSVNG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CID 15586443) is 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is Cc1nc2sccn2c(=O)c1CCN1CCC(c2c[nH]c3ccccc23)CC1.
What is the InChIKey of 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is HEGHIGMRJKSVNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4OS/c1-15-17(21(27)26-12-13-28-22(26)24-15)8-11-25-9-6-16(7-10-25)19-14-23-20-5-3-2-4-18(19)20/h2-5,12-14,16,23H,6-11H2,1H3.
What are the key properties of 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 392.53 g/mol, XLogP of 3.97, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 15586443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).