C20H27F3N4O4S — CID 155864436
N-[2-[5-[(3,5-dimethylphenyl)methyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155864436) has the molecular formula C20H27F3N4O4S and a molecular weight of 476.52 g/mol. Its IUPAC name is N-[2-[5-[(3,5-dimethylphenyl)methyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[5-[(3,5-dimethylphenyl)methyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155864436 |
| Molecular Formula | C20H27F3N4O4S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | N-[2-[5-[(3,5-dimethylphenyl)methyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C)cc(CN2Cc3ccnn3C(CCNS(C)(=O)=O)C2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N4O2S.C2HF3O2/c1-14-8-15(2)10-16(9-14)11-21-12-17-4-6-19-22(17)18(13-21)5-7-20-25(3,23)24;3-2(4,5)1(6)7/h4,6,8-10,18,20H,5,7,11-13H2,1-3H3;(H,6,7) |
| InChIKey | BOZPHJQGLLNRIQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |