C18H22F3N3O4S — CID 155864453
2-(cyclopropylmethyl)-7-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole;2,2,2-trifluoroacetic acid (PubChem CID 155864453) has the molecular formula C18H22F3N3O4S and a molecular weight of 433.45 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-7-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(cyclopropylmethyl)-7-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155864453 |
| Molecular Formula | C18H22F3N3O4S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-(cyclopropylmethyl)-7-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(COCC2OCCc3cn(CC4CC4)nc32)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21N3O2S.C2HF3O2/c1-11-17-14(10-22-11)8-20-9-15-16-13(4-5-21-15)7-19(18-16)6-12-2-3-12;3-2(4,5)1(6)7/h7,10,12,15H,2-6,8-9H2,1H3;(H,6,7) |
| InChIKey | UKSAUMWCLZNZGF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |