C20H24F3N3O5 — CID 155864754
cyclopentyl (3aS,6aS)-5-oxo-4-(pyridin-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 155864754) has the molecular formula C20H24F3N3O5 and a molecular weight of 443.42 g/mol. Its IUPAC name is cyclopentyl (3aS,6aS)-5-oxo-4-(pyridin-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | cyclopentyl (3aS,6aS)-5-oxo-4-(pyridin-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155864754 |
| Molecular Formula | C20H24F3N3O5 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | cyclopentyl (3aS,6aS)-5-oxo-4-(pyridin-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1C[C@H]2[C@H](CCN2C(=O)OC2CCCC2)N1Cc1cccnc1 |
| InChI | InChI=1S/C18H23N3O3.C2HF3O2/c22-17-10-16-15(21(17)12-13-4-3-8-19-11-13)7-9-20(16)18(23)24-14-5-1-2-6-14;3-2(4,5)1(6)7/h3-4,8,11,14-16H,1-2,5-7,9-10,12H2;(H,6,7)/t15-,16-;/m0./s1 |
| InChIKey | GXQHSBNZSACDDW-MOGJOVFKSA-N |
| XLogP | 2.97 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |