C27H29F8N3O6 — CID 155865225
2-(2,3-difluorophenyl)-1-[(5R,9S)-7-methyl-9-(pyridin-3-ylmethoxymethyl)-2,7-diazaspiro[4.4]nonan-2-yl]ethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155865225) has the molecular formula C27H29F8N3O6 and a molecular weight of 643.53 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-1-[(5R,9S)-7-methyl-9-(pyridin-3-ylmethoxymethyl)-2,7-diazaspiro[4.4]nonan-2-yl]ethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(2,3-difluorophenyl)-1-[(5R,9S)-7-methyl-9-(pyridin-3-ylmethoxymethyl)-2,7-diazaspiro[4.4]nonan-2-yl]ethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155865225 |
| Molecular Formula | C27H29F8N3O6 |
| Molecular Weight | 643.53 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | 2-(2,3-difluorophenyl)-1-[(5R,9S)-7-methyl-9-(pyridin-3-ylmethoxymethyl)-2,7-diazaspiro[4.4]nonan-2-yl]ethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1C[C@@H](COCc2cccnc2)[C@]2(CCN(C(=O)Cc3cccc(F)c3F)C2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H27F2N3O2.2C2HF3O2/c1-27-12-19(14-30-13-17-4-3-8-26-11-17)23(15-27)7-9-28(16-23)21(29)10-18-5-2-6-20(24)22(18)25;2*3-2(4,5)1(6)7/h2-6,8,11,19H,7,9-10,12-16H2,1H3;2*(H,6,7)/t19-,23+;;/m0../s1 |
| InChIKey | ROEZLOHDFOJCMI-YJKXCHRFSA-N |
| XLogP | 4.17 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |