C16H24F3N5O4 — CID 155865235
[(5aR,9aS)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155865235) has the molecular formula C16H24F3N5O4 and a molecular weight of 407.39 g/mol. Its IUPAC name is [(5aR,9aS)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(5aR,9aS)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155865235 |
| Molecular Formula | C16H24F3N5O4 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [(5aR,9aS)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CCO[C@@H]2CN(C(=O)c3ncn(C)n3)CC[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H23N5O2.C2HF3O2/c1-3-18-6-7-21-12-9-19(5-4-11(12)8-18)14(20)13-15-10-17(2)16-13;3-2(4,5)1(6)7/h10-12H,3-9H2,1-2H3;(H,6,7)/t11-,12-;/m1./s1 |
| InChIKey | MYJNUCPNVHZANS-MNMPKAIFSA-N |
| XLogP | 0.63 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |