C19H26F4N4O4 — CID 155865239
(1-fluorocyclobutyl)-[6-(morpholin-4-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155865239) has the molecular formula C19H26F4N4O4 and a molecular weight of 450.43 g/mol. Its IUPAC name is (1-fluorocyclobutyl)-[6-(morpholin-4-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (1-fluorocyclobutyl)-[6-(morpholin-4-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155865239 |
| Molecular Formula | C19H26F4N4O4 |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (1-fluorocyclobutyl)-[6-(morpholin-4-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(N1Cc2nccn2CC(CN2CCOCC2)C1)C1(F)CCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25FN4O2.C2HF3O2/c18-17(2-1-3-17)16(23)22-12-14(10-20-6-8-24-9-7-20)11-21-5-4-19-15(21)13-22;3-2(4,5)1(6)7/h4-5,14H,1-3,6-13H2;(H,6,7) |
| InChIKey | DICAZSJUUYFZSX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |