C25H31F3N4O4 — CID 155865862
14-[(dimethylamino)methyl]-5-(3,5-dimethylbenzoyl)-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155865862) has the molecular formula C25H31F3N4O4 and a molecular weight of 508.54 g/mol. Its IUPAC name is 14-[(dimethylamino)methyl]-5-(3,5-dimethylbenzoyl)-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 14-[(dimethylamino)methyl]-5-(3,5-dimethylbenzoyl)-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155865862 |
| Molecular Formula | C25H31F3N4O4 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 14-[(dimethylamino)methyl]-5-(3,5-dimethylbenzoyl)-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9-dien-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C)cc(C(=O)N2CCc3nc4n(c(=O)c3C2)C(CN(C)C)CCC4)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H30N4O2.C2HF3O2/c1-15-10-16(2)12-17(11-15)22(28)26-9-8-20-19(14-26)23(29)27-18(13-25(3)4)6-5-7-21(27)24-20;3-2(4,5)1(6)7/h10-12,18H,5-9,13-14H2,1-4H3;(H,6,7) |
| InChIKey | WAHUJISPURAXJK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |