C21H21F3N4O4S — CID 155866161
N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-2-methyl-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155866161) has the molecular formula C21H21F3N4O4S and a molecular weight of 482.48 g/mol. Its IUPAC name is N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-2-methyl-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-2-methyl-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155866161 |
| Molecular Formula | C21H21F3N4O4S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-2-methyl-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(C(=O)NCC2OCCc3cn(Cc4ccccc4)nc32)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H20N4O2S.C2HF3O2/c1-13-21-16(12-26-13)19(24)20-9-17-18-15(7-8-25-17)11-23(22-18)10-14-5-3-2-4-6-14;3-2(4,5)1(6)7/h2-6,11-12,17H,7-10H2,1H3,(H,20,24);(H,6,7) |
| InChIKey | GEPRXXHSKPNRCE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |