C27H25F3N2O6S — CID 155866386
1-[7-(2-methoxy-3-pyridinyl)-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-2-yl]-2-(2-methylphenyl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155866386) has the molecular formula C27H25F3N2O6S and a molecular weight of 562.57 g/mol. Its IUPAC name is 1-[7-(2-methoxy-3-pyridinyl)-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-2-yl]-2-(2-methylphenyl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[7-(2-methoxy-3-pyridinyl)-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-2-yl]-2-(2-methylphenyl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155866386 |
| Molecular Formula | C27H25F3N2O6S |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | 1-[7-(2-methoxy-3-pyridinyl)-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-2-yl]-2-(2-methylphenyl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | COc1ncccc1-c1ccc2c(c1)C1CN(C(=O)Cc3ccccc3C)CC1S2(=O)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H24N2O4S.C2HF3O2/c1-16-6-3-4-7-17(16)13-24(28)27-14-21-20-12-18(19-8-5-11-26-25(19)31-2)9-10-22(20)32(29,30)23(21)15-27;3-2(4,5)1(6)7/h3-12,21,23H,13-15H2,1-2H3;(H,6,7) |
| InChIKey | ULIDPSZXQYHVNP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |