C25H28F3N3O6 — CID 155867139
[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1,8-diazaspiro[3.5]nonan-8-yl]-(7-methoxy-1-benzofuran-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155867139) has the molecular formula C25H28F3N3O6 and a molecular weight of 523.51 g/mol. Its IUPAC name is [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1,8-diazaspiro[3.5]nonan-8-yl]-(7-methoxy-1-benzofuran-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1,8-diazaspiro[3.5]nonan-8-yl]-(7-methoxy-1-benzofuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155867139 |
| Molecular Formula | C25H28F3N3O6 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1,8-diazaspiro[3.5]nonan-8-yl]-(7-methoxy-1-benzofuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc2cc(C(=O)N3CCCC4(CCN4Cc4c(C)noc4C)C3)oc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H27N3O4.C2HF3O2/c1-15-18(16(2)30-24-15)13-26-11-9-23(26)8-5-10-25(14-23)22(27)20-12-17-6-4-7-19(28-3)21(17)29-20;3-2(4,5)1(6)7/h4,6-7,12H,5,8-11,13-14H2,1-3H3;(H,6,7) |
| InChIKey | SFRDJOUBAVUOBH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |