C26H29F3N4O4 — CID 155867706
[4-(dimethylamino)phenyl]-[3-[3-(methoxymethyl)phenyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155867706) has the molecular formula C26H29F3N4O4 and a molecular weight of 518.54 g/mol. Its IUPAC name is [4-(dimethylamino)phenyl]-[3-[3-(methoxymethyl)phenyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4-(dimethylamino)phenyl]-[3-[3-(methoxymethyl)phenyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155867706 |
| Molecular Formula | C26H29F3N4O4 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | [4-(dimethylamino)phenyl]-[3-[3-(methoxymethyl)phenyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | COCc1cccc(-c2cnc3n2CCN(C(=O)c2ccc(N(C)C)cc2)CC3)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H28N4O2.C2HF3O2/c1-26(2)21-9-7-19(8-10-21)24(29)27-12-11-23-25-16-22(28(23)14-13-27)20-6-4-5-18(15-20)17-30-3;3-2(4,5)1(6)7/h4-10,15-16H,11-14,17H2,1-3H3;(H,6,7) |
| InChIKey | QDXGVEVBIKLEMZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |