C19H23F3N4O3S2 — CID 155867856
9-(1,3-thiazol-2-ylmethyl)-1-(1,3-thiazol-5-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155867856) has the molecular formula C19H23F3N4O3S2 and a molecular weight of 476.55 g/mol. Its IUPAC name is 9-(1,3-thiazol-2-ylmethyl)-1-(1,3-thiazol-5-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 9-(1,3-thiazol-2-ylmethyl)-1-(1,3-thiazol-5-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155867856 |
| Molecular Formula | C19H23F3N4O3S2 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 9-(1,3-thiazol-2-ylmethyl)-1-(1,3-thiazol-5-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CCC2(CCCN(Cc3nccs3)CC2)N1Cc1cncs1 |
| InChI | InChI=1S/C17H22N4OS2.C2HF3O2/c22-16-2-4-17(21(16)11-14-10-18-13-24-14)3-1-7-20(8-5-17)12-15-19-6-9-23-15;3-2(4,5)1(6)7/h6,9-10,13H,1-5,7-8,11-12H2;(H,6,7) |
| InChIKey | JGGLINOBMBMFKB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |