C22H21F2N3O4 — CID 155868478
N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-3,4-difluorobenzamide;formic acid (PubChem CID 155868478) has the molecular formula C22H21F2N3O4 and a molecular weight of 429.42 g/mol. Its IUPAC name is N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-3,4-difluorobenzamide;formic acid.
| Compound Name | N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-3,4-difluorobenzamide;formic acid |
|---|---|
| PubChem CID | 155868478 |
| Molecular Formula | C22H21F2N3O4 |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-3,4-difluorobenzamide;formic acid |
| SMILES | O=C(NCC1OCCc2cn(Cc3ccccc3)nc21)c1ccc(F)c(F)c1.O=CO |
| InChI | InChI=1S/C21H19F2N3O2.CH2O2/c22-17-7-6-15(10-18(17)23)21(27)24-11-19-20-16(8-9-28-19)13-26(25-20)12-14-4-2-1-3-5-14;2-1-3/h1-7,10,13,19H,8-9,11-12H2,(H,24,27);1H,(H,2,3) |
| InChIKey | OKGCTHUXOREAFE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|