C7H15NO4 — CID 15586858
5-amino-1-methylcyclohexane-1,2,3,4-tetrol (PubChem CID 15586858) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is 5-amino-1-methylcyclohexane-1,2,3,4-tetrol.
| Compound Name | 5-amino-1-methylcyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 15586858 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 5-amino-1-methylcyclohexane-1,2,3,4-tetrol |
| SMILES | CC1(O)CC(N)C(O)C(O)C1O |
| InChI | InChI=1S/C7H15NO4/c1-7(12)2-3(8)4(9)5(10)6(7)11/h3-6,9-12H,2,8H2,1H3 |
| InChIKey | GRMBOCXLNMKQRW-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |