C19H26F3N3O5 — CID 155868833
(3aR,7aR)-N-cyclopropyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155868833) has the molecular formula C19H26F3N3O5 and a molecular weight of 433.43 g/mol. Its IUPAC name is (3aR,7aR)-N-cyclopropyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,7aR)-N-cyclopropyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155868833 |
| Molecular Formula | C19H26F3N3O5 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (3aR,7aR)-N-cyclopropyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1noc(C)c1CN1CC[C@H]2OCC[C@@]2(C(=O)NC2CC2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O3.C2HF3O2/c1-11-14(12(2)23-19-11)9-20-7-5-15-17(10-20,6-8-22-15)16(21)18-13-3-4-13;3-2(4,5)1(6)7/h13,15H,3-10H2,1-2H3,(H,18,21);(H,6,7)/t15-,17-;/m1./s1 |
| InChIKey | FQZFADJBJJHKIJ-SSPJITILSA-N |
| XLogP | 2.18 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |