C17H19F3N4O3S2 — CID 155868961
[(3aR,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155868961) has the molecular formula C17H19F3N4O3S2 and a molecular weight of 448.49 g/mol. Its IUPAC name is [(3aR,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155868961 |
| Molecular Formula | C17H19F3N4O3S2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | [(3aR,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1cscn1)N1CC[C@@H]2CN(Cc3nccs3)C[C@@H]2C1 |
| InChI | InChI=1S/C15H18N4OS2.C2HF3O2/c20-15(13-9-21-10-17-13)19-3-1-11-5-18(6-12(11)7-19)8-14-16-2-4-22-14;3-2(4,5)1(6)7/h2,4,9-12H,1,3,5-8H2;(H,6,7)/t11-,12-;/m1./s1 |
| InChIKey | JSFAXVRKQFSRIF-MNMPKAIFSA-N |
| XLogP | 2.83 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |