C18H21F3N4O2S — CID 155869088
N-cyclopropyl-7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 155869088) has the molecular formula C18H21F3N4O2S and a molecular weight of 414.45 g/mol. Its IUPAC name is N-cyclopropyl-7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclopropyl-7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155869088 |
| Molecular Formula | C18H21F3N4O2S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-cyclopropyl-7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1nc2c(c(NC3CC3)n1)CCN(Cc1ccsc1)CC2 |
| InChI | InChI=1S/C16H20N4S.C2HF3O2/c1-2-13(1)19-16-14-3-6-20(9-12-5-8-21-10-12)7-4-15(14)17-11-18-16;3-2(4,5)1(6)7/h5,8,10-11,13H,1-4,6-7,9H2,(H,17,18,19);(H,6,7) |
| InChIKey | RYLRBGHXFARJDA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |