C23H28F3N5O4 — CID 155869235
cyclopropyl-[3-(4-methoxyphenyl)-7-methylspiro[6,8-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-5,4'-piperidine]-1'-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155869235) has the molecular formula C23H28F3N5O4 and a molecular weight of 495.50 g/mol. Its IUPAC name is cyclopropyl-[3-(4-methoxyphenyl)-7-methylspiro[6,8-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-5,4'-piperidine]-1'-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | cyclopropyl-[3-(4-methoxyphenyl)-7-methylspiro[6,8-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-5,4'-piperidine]-1'-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155869235 |
| Molecular Formula | C23H28F3N5O4 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | cyclopropyl-[3-(4-methoxyphenyl)-7-methylspiro[6,8-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-5,4'-piperidine]-1'-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(-c2nnc3n2C2(CCN(C(=O)C4CC4)CC2)CN(C)C3)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H27N5O2.C2HF3O2/c1-24-13-18-22-23-19(15-5-7-17(28-2)8-6-15)26(18)21(14-24)9-11-25(12-10-21)20(27)16-3-4-16;3-2(4,5)1(6)7/h5-8,16H,3-4,9-14H2,1-2H3;(H,6,7) |
| InChIKey | MQGSMUXZCBZHTJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |