C21H28N6O7S — CID 155870482
N-(2-methoxyethyl)-1'-(2-methyl-1,3-thiazole-4-carbonyl)spiro[5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-a]azepine-7,3'-pyrrolidine]-3-carboxamide;oxalic acid (PubChem CID 155870482) has the molecular formula C21H28N6O7S and a molecular weight of 508.56 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1'-(2-methyl-1,3-thiazole-4-carbonyl)spiro[5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-a]azepine-7,3'-pyrrolidine]-3-carboxamide;oxalic acid.
| Compound Name | N-(2-methoxyethyl)-1'-(2-methyl-1,3-thiazole-4-carbonyl)spiro[5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-a]azepine-7,3'-pyrrolidine]-3-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 155870482 |
| Molecular Formula | C21H28N6O7S |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | N-(2-methoxyethyl)-1'-(2-methyl-1,3-thiazole-4-carbonyl)spiro[5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-a]azepine-7,3'-pyrrolidine]-3-carboxamide;oxalic acid |
| SMILES | COCCNC(=O)c1nnc2n1CCC1(CC2)CCN(C(=O)c2csc(C)n2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H26N6O3S.C2H2O4/c1-13-21-14(11-29-13)18(27)24-8-5-19(12-24)4-3-15-22-23-16(25(15)9-6-19)17(26)20-7-10-28-2;3-1(4)2(5)6/h11H,3-10,12H2,1-2H3,(H,20,26);(H,3,4)(H,5,6) |
| InChIKey | COBZXWWQHHKABU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 176.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|