About prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate
prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate (PubChem CID 15587061) has the molecular formula C20H17ClN4O4
and a molecular weight of 412.83 g/mol. Its IUPAC name is prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate.
Molecular Properties
| Compound Name | prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate |
| PubChem CID | 15587061 |
| Molecular Formula | C20H17ClN4O4 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate |
| SMILES | C#CCOC(=O)C(C)Oc1ccc(N(C)c2nc3ccc(Cl)cc3[n+]([O-])n2)cc1 |
| InChI | InChI=1S/C20H17ClN4O4/c1-4-11-28-19(26)13(2)29-16-8-6-15(7-9-16)24(3)20-22-17-10-5-14(21)12-18(17)25(27)23-20/h1,5-10,12-13H,11H2,2-3H3 |
| InChIKey | YRXQTVUPTXTURW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate?
The IUPAC name of prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate (CID 15587061) is prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate.
What is the SMILES notation for prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate?
The canonical SMILES for prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate is C#CCOC(=O)C(C)Oc1ccc(N(C)c2nc3ccc(Cl)cc3[n+]([O-])n2)cc1.
What is the InChIKey of prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate?
The InChIKey is YRXQTVUPTXTURW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN4O4/c1-4-11-28-19(26)13(2)29-16-8-6-15(7-9-16)24(3)20-22-17-10-5-14(21)12-18(17)25(27)23-20/h1,5-10,12-13H,11H2,2-3H3.
What are the key properties of prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate?
prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate has a molecular weight of 412.83 g/mol, XLogP of 2.63, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate is sourced from PubChem (CID 15587061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).