C16H24FN3O5S — CID 155870942
4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid (PubChem CID 155870942) has the molecular formula C16H24FN3O5S and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid.
| Compound Name | 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 155870942 |
| Molecular Formula | C16H24FN3O5S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid |
| SMILES | CN(C)C(=O)C1(Nc2cccc(F)c2)CCN(S(C)(=O)=O)CC1.O=CO |
| InChI | InChI=1S/C15H22FN3O3S.CH2O2/c1-18(2)14(20)15(17-13-6-4-5-12(16)11-13)7-9-19(10-8-15)23(3,21)22;2-1-3/h4-6,11,17H,7-10H2,1-3H3;1H,(H,2,3) |
| InChIKey | UCSAPSOEMNLJGS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|