About 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid
4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid (PubChem CID 155870942) has the molecular formula C16H24FN3O5S
and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid.
Molecular Properties
| Compound Name | 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid |
| PubChem CID | 155870942 |
| Molecular Formula | C16H24FN3O5S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid |
| SMILES | CN(C)C(=O)C1(Nc2cccc(F)c2)CCN(S(C)(=O)=O)CC1.O=CO |
| InChI | InChI=1S/C15H22FN3O3S.CH2O2/c1-18(2)14(20)15(17-13-6-4-5-12(16)11-13)7-9-19(10-8-15)23(3,21)22;2-1-3/h4-6,11,17H,7-10H2,1-3H3;1H,(H,2,3) |
| InChIKey | UCSAPSOEMNLJGS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid?
The IUPAC name of 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid (CID 155870942) is 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid.
What is the SMILES notation for 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid?
The canonical SMILES for 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid is CN(C)C(=O)C1(Nc2cccc(F)c2)CCN(S(C)(=O)=O)CC1.O=CO.
What is the InChIKey of 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid?
The InChIKey is UCSAPSOEMNLJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22FN3O3S.CH2O2/c1-18(2)14(20)15(17-13-6-4-5-12(16)11-13)7-9-19(10-8-15)23(3,21)22;2-1-3/h4-6,11,17H,7-10H2,1-3H3;1H,(H,2,3).
What are the key properties of 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid?
4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid has a molecular weight of 389.45 g/mol, XLogP of 0.82, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluoroanilino)-N,N-dimethyl-1-methylsulfonylpiperidine-4-carboxamide;formic acid is sourced from PubChem (CID 155870942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).