C20H35N5O — CID 155871243
[1-(2-ethylbutyl)-4-[(1-methylpyrazol-3-yl)amino]piperidin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 155871243) has the molecular formula C20H35N5O and a molecular weight of 361.53 g/mol. Its IUPAC name is [1-(2-ethylbutyl)-4-[(1-methylpyrazol-3-yl)amino]piperidin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-(2-ethylbutyl)-4-[(1-methylpyrazol-3-yl)amino]piperidin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 155871243 |
| Molecular Formula | C20H35N5O |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | [1-(2-ethylbutyl)-4-[(1-methylpyrazol-3-yl)amino]piperidin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CCC(CC)CN1CCC(Nc2ccn(C)n2)(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C20H35N5O/c1-4-17(5-2)16-24-14-9-20(10-15-24,19(26)25-11-6-7-12-25)21-18-8-13-23(3)22-18/h8,13,17H,4-7,9-12,14-16H2,1-3H3,(H,21,22) |
| InChIKey | QBNSPQYTZUYXBT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |