C15H19F3N4O2 — CID 155871298
6-N-(cyclopropylmethyl)-1-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide (PubChem CID 155871298) has the molecular formula C15H19F3N4O2 and a molecular weight of 344.34 g/mol. Its IUPAC name is 6-N-(cyclopropylmethyl)-1-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide.
| Compound Name | 6-N-(cyclopropylmethyl)-1-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide |
|---|---|
| PubChem CID | 155871298 |
| Molecular Formula | C15H19F3N4O2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 6-N-(cyclopropylmethyl)-1-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ncn2c1CCC(C(=O)NCC1CC1)C2 |
| InChI | InChI=1S/C15H19F3N4O2/c16-15(17,18)7-20-14(24)12-11-4-3-10(6-22(11)8-21-12)13(23)19-5-9-1-2-9/h8-10H,1-7H2,(H,19,23)(H,20,24) |
| InChIKey | AGZPPZXTKDDLAC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |