C15H19F3N4O2 — CID 155871437
6-(pyrrolidine-1-carbonyl)-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 155871437) has the molecular formula C15H19F3N4O2 and a molecular weight of 344.34 g/mol. Its IUPAC name is 6-(pyrrolidine-1-carbonyl)-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | 6-(pyrrolidine-1-carbonyl)-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 155871437 |
| Molecular Formula | C15H19F3N4O2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 6-(pyrrolidine-1-carbonyl)-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ncn2c1CCC(C(=O)N1CCCC1)C2 |
| InChI | InChI=1S/C15H19F3N4O2/c16-15(17,18)8-19-13(23)12-11-4-3-10(7-22(11)9-20-12)14(24)21-5-1-2-6-21/h9-10H,1-8H2,(H,19,23) |
| InChIKey | UAIIDVQUTATXPY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |