C16H21F3N4O2 — CID 155871885
6-N-cyclopentyl-1-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide (PubChem CID 155871885) has the molecular formula C16H21F3N4O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is 6-N-cyclopentyl-1-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide.
| Compound Name | 6-N-cyclopentyl-1-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide |
|---|---|
| PubChem CID | 155871885 |
| Molecular Formula | C16H21F3N4O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 6-N-cyclopentyl-1-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ncn2c1CCC(C(=O)NC1CCCC1)C2 |
| InChI | InChI=1S/C16H21F3N4O2/c17-16(18,19)8-20-15(25)13-12-6-5-10(7-23(12)9-21-13)14(24)22-11-3-1-2-4-11/h9-11H,1-8H2,(H,20,25)(H,22,24) |
| InChIKey | IFLMJTVJVHEQJN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |