C19H20FN3O2S — CID 155872984
3-(3-fluoroanilino)-N-methyl-1-[(E)-3-thiophen-2-ylprop-2-enoyl]pyrrolidine-3-carboxamide (PubChem CID 155872984) has the molecular formula C19H20FN3O2S and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-(3-fluoroanilino)-N-methyl-1-[(E)-3-thiophen-2-ylprop-2-enoyl]pyrrolidine-3-carboxamide.
| Compound Name | 3-(3-fluoroanilino)-N-methyl-1-[(E)-3-thiophen-2-ylprop-2-enoyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155872984 |
| Molecular Formula | C19H20FN3O2S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 3-(3-fluoroanilino)-N-methyl-1-[(E)-3-thiophen-2-ylprop-2-enoyl]pyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(Nc2cccc(F)c2)CCN(C(=O)/C=C/c2cccs2)C1 |
| InChI | InChI=1S/C19H20FN3O2S/c1-21-18(25)19(22-15-5-2-4-14(20)12-15)9-10-23(13-19)17(24)8-7-16-6-3-11-26-16/h2-8,11-12,22H,9-10,13H2,1H3,(H,21,25)/b8-7+ |
| InChIKey | JUKMPFYXBZFZCG-BQYQJAHWSA-N |
| XLogP | 2.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|