C20H28N6O4S — CID 15587305
4-(1,3-diethyl-2,6-dioxo-7H-purin-8-yl)-N-[3-(dimethylamino)propyl]benzenesulfonamide (PubChem CID 15587305) has the molecular formula C20H28N6O4S and a molecular weight of 448.55 g/mol. Its IUPAC name is 4-(1,3-diethyl-2,6-dioxo-7H-purin-8-yl)-N-[3-(dimethylamino)propyl]benzenesulfonamide.
| Compound Name | 4-(1,3-diethyl-2,6-dioxo-7H-purin-8-yl)-N-[3-(dimethylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 15587305 |
| Molecular Formula | C20H28N6O4S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 4-(1,3-diethyl-2,6-dioxo-7H-purin-8-yl)-N-[3-(dimethylamino)propyl]benzenesulfonamide |
| SMILES | CCn1c(=O)c2[nH]c(-c3ccc(S(=O)(=O)NCCCN(C)C)cc3)nc2n(CC)c1=O |
| InChI | InChI=1S/C20H28N6O4S/c1-5-25-18-16(19(27)26(6-2)20(25)28)22-17(23-18)14-8-10-15(11-9-14)31(29,30)21-12-7-13-24(3)4/h8-11,21H,5-7,12-13H2,1-4H3,(H,22,23) |
| InChIKey | YDVYKMVYLILBHP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|