C18H22N4O2S — CID 155874544
N-(cyclopropylmethyl)-4-pyrazol-1-yl-1-(thiophene-3-carbonyl)piperidine-4-carboxamide (PubChem CID 155874544) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-pyrazol-1-yl-1-(thiophene-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-4-pyrazol-1-yl-1-(thiophene-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155874544 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-(cyclopropylmethyl)-4-pyrazol-1-yl-1-(thiophene-3-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(c1ccsc1)N1CCC(C(=O)NCC2CC2)(n2cccn2)CC1 |
| InChI | InChI=1S/C18H22N4O2S/c23-16(15-4-11-25-13-15)21-9-5-18(6-10-21,22-8-1-7-20-22)17(24)19-12-14-2-3-14/h1,4,7-8,11,13-14H,2-3,5-6,9-10,12H2,(H,19,24) |
| InChIKey | VCVFFWINGNKFIN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |