About 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate
2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate (PubChem CID 155874857) has the molecular formula C20H31N3O3S
and a molecular weight of 393.55 g/mol. Its IUPAC name is 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate |
| PubChem CID | 155874857 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate |
| SMILES | Cc1ncsc1C(=O)N1CCCCC1C1CCN(C(=O)OCC(C)C)CC1 |
| InChI | InChI=1S/C20H31N3O3S/c1-14(2)12-26-20(25)22-10-7-16(8-11-22)17-6-4-5-9-23(17)19(24)18-15(3)21-13-27-18/h13-14,16-17H,4-12H2,1-3H3 |
| InChIKey | CROVRLJUKKCKMZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate?
The IUPAC name of 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate (CID 155874857) is 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate.
What is the SMILES notation for 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate?
The canonical SMILES for 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate is Cc1ncsc1C(=O)N1CCCCC1C1CCN(C(=O)OCC(C)C)CC1.
What is the InChIKey of 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate?
The InChIKey is CROVRLJUKKCKMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N3O3S/c1-14(2)12-26-20(25)22-10-7-16(8-11-22)17-6-4-5-9-23(17)19(24)18-15(3)21-13-27-18/h13-14,16-17H,4-12H2,1-3H3.
What are the key properties of 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate?
2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate has a molecular weight of 393.55 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-2-yl]piperidine-1-carboxylate is sourced from PubChem (CID 155874857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).