C17H22INO3 — CID 155875113
2-(4-hydroxyphenyl)-1-[3-(iodomethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]ethanone (PubChem CID 155875113) has the molecular formula C17H22INO3 and a molecular weight of 415.27 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-1-[3-(iodomethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]ethanone.
| Compound Name | 2-(4-hydroxyphenyl)-1-[3-(iodomethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]ethanone |
|---|---|
| PubChem CID | 155875113 |
| Molecular Formula | C17H22INO3 |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 2-(4-hydroxyphenyl)-1-[3-(iodomethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]ethanone |
| SMILES | O=C(Cc1ccc(O)cc1)N1CCC2(CC1)COC(CI)C2 |
| InChI | InChI=1S/C17H22INO3/c18-11-15-10-17(12-22-15)5-7-19(8-6-17)16(21)9-13-1-3-14(20)4-2-13/h1-4,15,20H,5-12H2 |
| InChIKey | BVMDPQNPEMXRDB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|