C17H22FN3O2 — CID 155875314
[(4aS,8aS)-1-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazin-6-yl]-(1-fluorocyclopropyl)methanone (PubChem CID 155875314) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is [(4aS,8aS)-1-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazin-6-yl]-(1-fluorocyclopropyl)methanone.
| Compound Name | [(4aS,8aS)-1-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazin-6-yl]-(1-fluorocyclopropyl)methanone |
|---|---|
| PubChem CID | 155875314 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | [(4aS,8aS)-1-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazin-6-yl]-(1-fluorocyclopropyl)methanone |
| SMILES | O=C(N1CC[C@H]2[C@H](C1)OCCN2Cc1ccncc1)C1(F)CC1 |
| InChI | InChI=1S/C17H22FN3O2/c18-17(4-5-17)16(22)21-8-3-14-15(12-21)23-10-9-20(14)11-13-1-6-19-7-2-13/h1-2,6-7,14-15H,3-5,8-12H2/t14-,15-/m0/s1 |
| InChIKey | XQECRLUDMDCKNI-GJZGRUSLSA-N |
| XLogP | 1.39 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |