C17H24FN7O2 — CID 155876453
1-(5-fluoropyrimidin-2-yl)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide (PubChem CID 155876453) has the molecular formula C17H24FN7O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-(5-fluoropyrimidin-2-yl)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide.
| Compound Name | 1-(5-fluoropyrimidin-2-yl)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155876453 |
| Molecular Formula | C17H24FN7O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-(5-fluoropyrimidin-2-yl)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1(Nc2ccn(C)n2)CCN(c2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C17H24FN7O2/c1-24-7-3-14(23-24)22-17(15(26)19-6-10-27-2)4-8-25(9-5-17)16-20-11-13(18)12-21-16/h3,7,11-12H,4-6,8-10H2,1-2H3,(H,19,26)(H,22,23) |
| InChIKey | WEMZTOIDYLBEKK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|