C20H27N5O — CID 155877153
[(3aS,8aR)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-methyl-2-pyridinyl)methanone (PubChem CID 155877153) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is [(3aS,8aR)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-methyl-2-pyridinyl)methanone.
| Compound Name | [(3aS,8aR)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-methyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 155877153 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | [(3aS,8aR)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-methyl-2-pyridinyl)methanone |
| SMILES | Cc1cccnc1C(=O)N1C[C@H]2CCN(Cc3ccnn3C)CC[C@H]2C1 |
| InChI | InChI=1S/C20H27N5O/c1-15-4-3-8-21-19(15)20(26)25-12-16-6-10-24(11-7-17(16)13-25)14-18-5-9-22-23(18)2/h3-5,8-9,16-17H,6-7,10-14H2,1-2H3/t16-,17+ |
| InChIKey | SVEUIAYISCBZMS-CALCHBBNSA-N |
| XLogP | 2.11 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |