C22H32FN5O4 — CID 155877822
(3aR,8aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-(3-fluoro-2-pyridinyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepine;formic acid (PubChem CID 155877822) has the molecular formula C22H32FN5O4 and a molecular weight of 449.53 g/mol. Its IUPAC name is (3aR,8aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-(3-fluoro-2-pyridinyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepine;formic acid.
| Compound Name | (3aR,8aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-(3-fluoro-2-pyridinyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepine;formic acid |
|---|---|
| PubChem CID | 155877822 |
| Molecular Formula | C22H32FN5O4 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (3aR,8aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-(3-fluoro-2-pyridinyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepine;formic acid |
| SMILES | CCc1nc(CN2C[C@H]3CCN(c4ncccc4F)CC[C@H]3C2)c(C)[nH]1.O=CO.O=CO |
| InChI | InChI=1S/C20H28FN5.2CH2O2/c1-3-19-23-14(2)18(24-19)13-25-11-15-6-9-26(10-7-16(15)12-25)20-17(21)5-4-8-22-20;2*2-1-3/h4-5,8,15-16H,3,6-7,9-13H2,1-2H3,(H,23,24);2*1H,(H,2,3)/t15-,16+;; |
| InChIKey | WVNRTKGHHXBEHZ-TYIJTUDGSA-N |
| XLogP | 2.56 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|