C20H27N3O4 — CID 155878205
formic acid;5-(2-phenylethylamino)-N-propan-2-yl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide (PubChem CID 155878205) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is formic acid;5-(2-phenylethylamino)-N-propan-2-yl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide.
| Compound Name | formic acid;5-(2-phenylethylamino)-N-propan-2-yl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 155878205 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | formic acid;5-(2-phenylethylamino)-N-propan-2-yl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
| SMILES | CC(C)NC(=O)c1noc2c1CC(NCCc1ccccc1)CC2.O=CO |
| InChI | InChI=1S/C19H25N3O2.CH2O2/c1-13(2)21-19(23)18-16-12-15(8-9-17(16)24-22-18)20-11-10-14-6-4-3-5-7-14;2-1-3/h3-7,13,15,20H,8-12H2,1-2H3,(H,21,23);1H,(H,2,3) |
| InChIKey | ATNCCOWORNFSHX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|