C20H32N4O — CID 155878259
(E)-4-methyl-1-[8-[(2-methylpyrazol-3-yl)methyl]-2,8-diazaspiro[5.5]undecan-2-yl]pent-2-en-1-one (PubChem CID 155878259) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is (E)-4-methyl-1-[8-[(2-methylpyrazol-3-yl)methyl]-2,8-diazaspiro[5.5]undecan-2-yl]pent-2-en-1-one.
| Compound Name | (E)-4-methyl-1-[8-[(2-methylpyrazol-3-yl)methyl]-2,8-diazaspiro[5.5]undecan-2-yl]pent-2-en-1-one |
|---|---|
| PubChem CID | 155878259 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (E)-4-methyl-1-[8-[(2-methylpyrazol-3-yl)methyl]-2,8-diazaspiro[5.5]undecan-2-yl]pent-2-en-1-one |
| SMILES | CC(C)/C=C/C(=O)N1CCCC2(CCCN(Cc3ccnn3C)C2)C1 |
| InChI | InChI=1S/C20H32N4O/c1-17(2)6-7-19(25)24-13-5-10-20(16-24)9-4-12-23(15-20)14-18-8-11-21-22(18)3/h6-8,11,17H,4-5,9-10,12-16H2,1-3H3/b7-6+ |
| InChIKey | RZYDOUJIEIFCAG-VOTSOKGWSA-N |
| XLogP | 2.84 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|