C21H23N3O4S3 — CID 155879415
N-[(3-methoxyphenyl)methyl]-6-(3-methylthiophen-2-yl)sulfonyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide (PubChem CID 155879415) has the molecular formula C21H23N3O4S3 and a molecular weight of 477.63 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-6-(3-methylthiophen-2-yl)sulfonyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-6-(3-methylthiophen-2-yl)sulfonyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide |
|---|---|
| PubChem CID | 155879415 |
| Molecular Formula | C21H23N3O4S3 |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-6-(3-methylthiophen-2-yl)sulfonyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2nc3c(s2)CCN(S(=O)(=O)c2sccc2C)CC3)c1 |
| InChI | InChI=1S/C21H23N3O4S3/c1-14-8-11-29-21(14)31(26,27)24-9-6-17-18(7-10-24)30-20(23-17)19(25)22-13-15-4-3-5-16(12-15)28-2/h3-5,8,11-12H,6-7,9-10,13H2,1-2H3,(H,22,25) |
| InChIKey | SMMUFGVTJLRBBB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |