C19H28FN3O3 — CID 155879755
1-(2-ethoxyacetyl)-4-(3-fluoroanilino)-N-propan-2-ylpiperidine-4-carboxamide (PubChem CID 155879755) has the molecular formula C19H28FN3O3 and a molecular weight of 365.45 g/mol. Its IUPAC name is 1-(2-ethoxyacetyl)-4-(3-fluoroanilino)-N-propan-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-(2-ethoxyacetyl)-4-(3-fluoroanilino)-N-propan-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 155879755 |
| Molecular Formula | C19H28FN3O3 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-(2-ethoxyacetyl)-4-(3-fluoroanilino)-N-propan-2-ylpiperidine-4-carboxamide |
| SMILES | CCOCC(=O)N1CCC(Nc2cccc(F)c2)(C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C19H28FN3O3/c1-4-26-13-17(24)23-10-8-19(9-11-23,18(25)21-14(2)3)22-16-7-5-6-15(20)12-16/h5-7,12,14,22H,4,8-11,13H2,1-3H3,(H,21,25) |
| InChIKey | BYQRHINZGGJTEK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |