About 9-bromoacridine
9-bromoacridine (PubChem CID 15588290) has the molecular formula C13H8BrN
and a molecular weight of 258.12 g/mol. Its IUPAC name is 9-bromoacridine.
Molecular Properties
| Compound Name | 9-bromoacridine |
| PubChem CID | 15588290 |
| Molecular Formula | C13H8BrN |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 9-bromoacridine |
| SMILES | Brc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C13H8BrN/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
| InChIKey | NNTFCRCMYKVMPU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-bromoacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromoacridine?
The IUPAC name of 9-bromoacridine (CID 15588290) is 9-bromoacridine.
What is the SMILES notation for 9-bromoacridine?
The canonical SMILES for 9-bromoacridine is Brc1c2ccccc2nc2ccccc12.
What is the InChIKey of 9-bromoacridine?
The InChIKey is NNTFCRCMYKVMPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrN/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H.
What are the key properties of 9-bromoacridine?
9-bromoacridine has a molecular weight of 258.12 g/mol, XLogP of 4.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromoacridine is sourced from PubChem (CID 15588290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).