C19H20F2N4OS — CID 155882961
N-[4-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-4-phenylbutyl]-1,3-thiazole-2-carboxamide (PubChem CID 155882961) has the molecular formula C19H20F2N4OS and a molecular weight of 390.46 g/mol. Its IUPAC name is N-[4-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-4-phenylbutyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[4-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-4-phenylbutyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 155882961 |
| Molecular Formula | C19H20F2N4OS |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[4-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-4-phenylbutyl]-1,3-thiazole-2-carboxamide |
| SMILES | Cn1cc(C(CCCNC(=O)c2nccs2)c2ccccc2)c(C(F)F)n1 |
| InChI | InChI=1S/C19H20F2N4OS/c1-25-12-15(16(24-25)17(20)21)14(13-6-3-2-4-7-13)8-5-9-22-18(26)19-23-10-11-27-19/h2-4,6-7,10-12,14,17H,5,8-9H2,1H3,(H,22,26) |
| InChIKey | SCRRGUULFVKZFJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|