About N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide
N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide (PubChem CID 155882993) has the molecular formula C20H14F4N2O4S
and a molecular weight of 454.40 g/mol. Its IUPAC name is N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide.
Molecular Properties
| Compound Name | N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide |
| PubChem CID | 155882993 |
| Molecular Formula | C20H14F4N2O4S |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)Nc2ccc(OC(F)F)cc2)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H14F4N2O4S/c21-13-8-12(9-14(22)10-13)19(27)25-16-2-1-3-18(11-16)31(28,29)26-15-4-6-17(7-5-15)30-20(23)24/h1-11,20,26H,(H,25,27) |
| InChIKey | RCXBNPJQQXMWGZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide?
The IUPAC name of N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide (CID 155882993) is N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide.
What is the SMILES notation for N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide?
The canonical SMILES for N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide is O=C(Nc1cccc(S(=O)(=O)Nc2ccc(OC(F)F)cc2)c1)c1cc(F)cc(F)c1.
What is the InChIKey of N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide?
The InChIKey is RCXBNPJQQXMWGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F4N2O4S/c21-13-8-12(9-14(22)10-13)19(27)25-16-2-1-3-18(11-16)31(28,29)26-15-4-6-17(7-5-15)30-20(23)24/h1-11,20,26H,(H,25,27).
What are the key properties of N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide?
N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide has a molecular weight of 454.40 g/mol, XLogP of 4.62, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[4-(difluoromethoxy)phenyl]sulfamoyl]phenyl]-3,5-difluorobenzamide is sourced from PubChem (CID 155882993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).