C15H22O5S — CID 155883008
(2S,3S,4R,5S,6S)-2-[(4-ethoxyphenyl)methylsulfanyl]-6-methyloxane-3,4,5-triol (PubChem CID 155883008) has the molecular formula C15H22O5S and a molecular weight of 314.40 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-2-[(4-ethoxyphenyl)methylsulfanyl]-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6S)-2-[(4-ethoxyphenyl)methylsulfanyl]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 155883008 |
| Molecular Formula | C15H22O5S |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2S,3S,4R,5S,6S)-2-[(4-ethoxyphenyl)methylsulfanyl]-6-methyloxane-3,4,5-triol |
| SMILES | CCOc1ccc(CS[C@@H]2O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C15H22O5S/c1-3-19-11-6-4-10(5-7-11)8-21-15-14(18)13(17)12(16)9(2)20-15/h4-7,9,12-18H,3,8H2,1-2H3/t9-,12+,13+,14-,15-/m0/s1 |
| InChIKey | BRIKQFUHODMCDB-KTDXIVQUSA-N |
| XLogP | 1.15 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |