C20H30FN4O4P+2 — CID 155883045
4-[(3S)-3-carboxy-1-[[4-fluoro-2-(3-methylimidazol-4-yl)phenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinan-1-ium-3-yl]butylazanium (PubChem CID 155883045) has the molecular formula C20H30FN4O4P+2 and a molecular weight of 440.46 g/mol. Its IUPAC name is 4-[(3S)-3-carboxy-1-[[4-fluoro-2-(3-methylimidazol-4-yl)phenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinan-1-ium-3-yl]butylazanium.
| Compound Name | 4-[(3S)-3-carboxy-1-[[4-fluoro-2-(3-methylimidazol-4-yl)phenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinan-1-ium-3-yl]butylazanium |
|---|---|
| PubChem CID | 155883045 |
| Molecular Formula | C20H30FN4O4P+2 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 4-[(3S)-3-carboxy-1-[[4-fluoro-2-(3-methylimidazol-4-yl)phenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinan-1-ium-3-yl]butylazanium |
| SMILES | Cn1cncc1-c1cc(F)ccc1C[NH+]1CCP(=O)(O)[C@](CCCC[NH3+])(C(=O)O)C1 |
| InChI | InChI=1S/C20H28FN4O4P/c1-24-14-23-11-18(24)17-10-16(21)5-4-15(17)12-25-8-9-30(28,29)20(13-25,19(26)27)6-2-3-7-22/h4-5,10-11,14H,2-3,6-9,12-13,22H2,1H3,(H,26,27)(H,28,29)/p+2/t20-/m0/s1 |
| InChIKey | ZBWZIBATIOSFOY-FQEVSTJZSA-P |
| XLogP | 0.13 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|