C16H17N5O5 — CID 155883056
5-[[[9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]furan-2-carbaldehyde (PubChem CID 155883056) has the molecular formula C16H17N5O5 and a molecular weight of 359.34 g/mol. Its IUPAC name is 5-[[[9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]furan-2-carbaldehyde.
| Compound Name | 5-[[[9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 155883056 |
| Molecular Formula | C16H17N5O5 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 5-[[[9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(CNc2ncnc3c2ncn3[C@H]2C[C@@H](O)[C@@H](CO)O2)o1 |
| InChI | InChI=1S/C16H17N5O5/c22-5-10-2-1-9(25-10)4-17-15-14-16(19-7-18-15)21(8-20-14)13-3-11(24)12(6-23)26-13/h1-2,5,7-8,11-13,23-24H,3-4,6H2,(H,17,18,19)/t11-,12-,13-/m1/s1 |
| InChIKey | GAGHSDSOHRFXTN-JHJVBQTASA-N |
| XLogP | 0.48 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|