C19H20F2N4O3 — CID 155883215
(1R,2S,3R,5S)-3-(2-amino-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(S)-(3,4-difluorophenyl)-hydroxymethyl]cyclopentane-1,2-diol (PubChem CID 155883215) has the molecular formula C19H20F2N4O3 and a molecular weight of 390.39 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-(2-amino-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(S)-(3,4-difluorophenyl)-hydroxymethyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-(2-amino-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(S)-(3,4-difluorophenyl)-hydroxymethyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 155883215 |
| Molecular Formula | C19H20F2N4O3 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (1R,2S,3R,5S)-3-(2-amino-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(S)-(3,4-difluorophenyl)-hydroxymethyl]cyclopentane-1,2-diol |
| SMILES | Cc1nc(N)nc2c1ccn2[C@@H]1C[C@@H]([C@H](O)c2ccc(F)c(F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H20F2N4O3/c1-8-10-4-5-25(18(10)24-19(22)23-8)14-7-11(16(27)17(14)28)15(26)9-2-3-12(20)13(21)6-9/h2-6,11,14-17,26-28H,7H2,1H3,(H2,22,23,24)/t11-,14+,15+,16+,17-/m0/s1 |
| InChIKey | SDRRUWHGQSBVST-JCGSOOFXSA-N |
| XLogP | 1.62 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |