C24H30ClN3O4 — CID 155883262
N-[[4-chloro-3-[4-[4-(2-methoxyethoxy)phenyl]-6-oxo-1,3-diazinan-2-yl]phenyl]methyl]-2-methylpropanamide (PubChem CID 155883262) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-[4-(2-methoxyethoxy)phenyl]-6-oxo-1,3-diazinan-2-yl]phenyl]methyl]-2-methylpropanamide.
| Compound Name | N-[[4-chloro-3-[4-[4-(2-methoxyethoxy)phenyl]-6-oxo-1,3-diazinan-2-yl]phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 155883262 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-[[4-chloro-3-[4-[4-(2-methoxyethoxy)phenyl]-6-oxo-1,3-diazinan-2-yl]phenyl]methyl]-2-methylpropanamide |
| SMILES | COCCOc1ccc(C2CC(=O)NC(c3cc(CNC(=O)C(C)C)ccc3Cl)N2)cc1 |
| InChI | InChI=1S/C24H30ClN3O4/c1-15(2)24(30)26-14-16-4-9-20(25)19(12-16)23-27-21(13-22(29)28-23)17-5-7-18(8-6-17)32-11-10-31-3/h4-9,12,15,21,23,27H,10-11,13-14H2,1-3H3,(H,26,30)(H,28,29) |
| InChIKey | NPAZHQHKYMOEJF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|