C27H35F3N4O4 — CID 155883365
N-[[3-[4-[6-(2-butoxyethoxy)-3-pyridinyl]-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide (PubChem CID 155883365) has the molecular formula C27H35F3N4O4 and a molecular weight of 536.60 g/mol. Its IUPAC name is N-[[3-[4-[6-(2-butoxyethoxy)-3-pyridinyl]-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide.
| Compound Name | N-[[3-[4-[6-(2-butoxyethoxy)-3-pyridinyl]-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 155883365 |
| Molecular Formula | C27H35F3N4O4 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | N-[[3-[4-[6-(2-butoxyethoxy)-3-pyridinyl]-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide |
| SMILES | CCCCOCCOc1ccc(C2CC(=O)NC(c3cc(CNC(=O)C(C)C)ccc3C(F)(F)F)N2)cn1 |
| InChI | InChI=1S/C27H35F3N4O4/c1-4-5-10-37-11-12-38-24-9-7-19(16-31-24)22-14-23(35)34-25(33-22)20-13-18(15-32-26(36)17(2)3)6-8-21(20)27(28,29)30/h6-9,13,16-17,22,25,33H,4-5,10-12,14-15H2,1-3H3,(H,32,36)(H,34,35) |
| InChIKey | ALUDGZHSGKUVQK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|