C19H19FN6O3 — CID 155883537
3-[[3-[(3R,5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 155883537) has the molecular formula C19H19FN6O3 and a molecular weight of 398.40 g/mol. Its IUPAC name is 3-[[3-[(3R,5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 3-[[3-[(3R,5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 155883537 |
| Molecular Formula | C19H19FN6O3 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3-[[3-[(3R,5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1ncn2c1C(=O)N(Cc1nc([C@@H]3CO[C@@H](c4ccc(F)cc4)C3)no1)CN2 |
| InChI | InChI=1S/C19H19FN6O3/c1-11-17-19(27)25(10-22-26(17)9-21-11)7-16-23-18(24-29-16)13-6-15(28-8-13)12-2-4-14(20)5-3-12/h2-5,9,13,15,22H,6-8,10H2,1H3/t13-,15+/m0/s1 |
| InChIKey | SAZDSJRADPJVRZ-DZGCQCFKSA-N |
| XLogP | 2.12 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |