C19H20FN7O3 — CID 155883543
2-amino-3-[[3-[(3R,5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 155883543) has the molecular formula C19H20FN7O3 and a molecular weight of 413.41 g/mol. Its IUPAC name is 2-amino-3-[[3-[(3R,5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-amino-3-[[3-[(3R,5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 155883543 |
| Molecular Formula | C19H20FN7O3 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-amino-3-[[3-[(3R,5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1ncn2c1C(=O)N(Cc1nc([C@@H]3CO[C@@H](c4ccc(F)cc4)C3)no1)C(N)N2 |
| InChI | InChI=1S/C19H20FN7O3/c1-10-16-18(28)26(19(21)24-27(16)9-22-10)7-15-23-17(25-30-15)12-6-14(29-8-12)11-2-4-13(20)5-3-11/h2-5,9,12,14,19,24H,6-8,21H2,1H3/t12-,14+,19?/m0/s1 |
| InChIKey | IJJNIWFDMOAIIP-OSHZWXCDSA-N |
| XLogP | 1.40 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |